| Synonyms | |
|---|---|
| Appearance | |
| Storage | Store in 2-8°C for long term (months) |
| Boiling point | |
| Melting point | |
| Flash point | |
| Pubchem ID | |
| Smiles | O1C([H])([H])OC2C([H])=C(C(C(C([H])([H])C([H])([H])[H])=O)=C([H])C1=2)OC([H])([H])[H] |
| InchiKey | XPHIRVUYIBXETG-UHFFFAOYSA-N |
| Inchi | InChI=1S/C11H12O4/c1-3-8(12)7-4-10-11(15-6-14-10)5-9(7)13-2/h4-5H,3,6H2,1-2H3 |
| GHS Pictogram | |
|---|---|
| Signal Word | |
| Class | |
| Precautionary Statements | |
| UN No. | |
| Hazard Statements | |
| Packing Group |
Sorry, the product description is not available.
Sorry, the literature is not available.
No record.
Competitive price
Fast logistics
Technical support
Stock in hand
