| Synonyms | |
|---|---|
| Appearance | liquid |
| Storage | Store in 2-8°C for long term (months) |
| Boiling point | 62-64 °C/35 mmHg(lit.) |
| Melting point | 236ºC |
| Flash point | |
| Pubchem ID | |
| Smiles | FC(C(F)(F)F)(C([H])([H])C([H])([H])C([H])([H])O[H])F |
| InchiKey | QROUUECTKRZFHF-UHFFFAOYSA-N |
| Inchi | InChI=1S/C5H7F5O/c6-4(7,2-1-3-11)5(8,9)10/h11H,1-3H2 |
| GHS Pictogram | |
|---|---|
| Signal Word | Warning |
| Class | |
| Precautionary Statements | P305+P351+P338 |
| UN No. | |
| Hazard Statements | H319 |
| Packing Group |
Sorry, the product description is not available.
Sorry, the literature is not available.
No record.
Competitive price
Fast logistics
Technical support
Stock in hand
