| Synonyms | |
|---|---|
| Appearance | |
| Storage | Store in 2-8°C for long term (months) |
| Boiling point | 281°C at 760 mmHg |
| Melting point | 113 ºC |
| Flash point | |
| Pubchem ID | |
| Smiles | O=C(/C(/[H])=C(\[H])/N(C([H])([H])[H])C([H])([H])[H])C1=C([H])N=C([H])C([H])=C1[H] |
| InchiKey | MZLRFUCMBQWLNV-FNORWQNLSA-N |
| Inchi | InChI=1S/C10H12N2O/c1-12(2)7-5-10(13)9-4-3-6-11-8-9/h3-8H,1-2H3/b7-5+ |
| GHS Pictogram | |
|---|---|
| Signal Word | Warning |
| Class | |
| Precautionary Statements | P261;P280;P305+P351+P338;P304+P340;P405;P501 |
| UN No. | |
| Hazard Statements | H302-H315-H319-H332-H335 |
| Packing Group |
Sorry, the product description is not available.
Sorry, the literature is not available.
Competitive price
Fast logistics
Technical support
Stock in hand
