| Synonyms | |
|---|---|
| Appearance | |
| Storage | Store in 2-8°C for long term (months) |
| Boiling point | |
| Melting point | |
| Flash point | |
| Pubchem ID | |
| Smiles | Cl.F[C@@H]1CC[C@@H](C1)N |
| InchiKey | MVFFVXDWLQQNEH-JBUOLDKXSA-N |
| Inchi | InChI=1S/C5H10FN.ClH/c6-4-1-2-5(7)3-4;/h4-5H,1-3,7H2;1H/t4-,5+;/m1./s1 |
| GHS Pictogram | |
|---|---|
| Signal Word | warning |
| Class | |
| Precautionary Statements | P264+P280+P305+P351+P338+P337+P313 |
| UN No. | |
| Hazard Statements | H303+H313+H333 |
| Packing Group |
Sorry, the product description is not available.
Sorry, the literature is not available.
Competitive price
Fast logistics
Technical support
Stock in hand
