{"config":{"displayName":"Specification","sql":"","validateSql":"","emailSql":"","emailSubjectSql":"","emailSccuessSql":"","displayNameSql":"","useage":0,"header":"","body":"<style>\n .fll { float: left; }\n .flr { float: right; }\n .title { font-size: 24pt; font-weight: bold; padding-bottom: 4mm; }\n\n table { width: 100%; border-collapse: collapse; border-spacing: 0; font-size: 13.5pt; }\n table td { border: 1px solid #ddd; padding: 2mm 4mm; }\n table th { border: 1px solid #ddd; padding: 2mm 4mm; }\n\n .table2 { width: 100%; margin-top: 8mm; }\n .table2 th { background-color: #FEEECF; font-size: 16pt; text-align: left; }\n .color1 { color: #f39800; }\n</style>\n<script>\n function pic(r) {\n var html = \"\";\n var arr = r.split(\";\");\n for (var i = 0; i < arr.length;i++) {\n html += \"<img style='margin-right:8px;max-height:10mm;' src='https://www.amadischem.com/res/image/hazardSymbols/\" + arr[i] + \".png'/>\"\n }\n return html;\n }\n</script>\n\n<div style=\" margin:10mm 20mm;height:100%;position:relative;font-size:13.5pt;font-family: Calibri;\">\n <div class=\"title\">\n <div class=\"fll\">Specification</div>\n <div class=\"flr\"><img src=\"https://www.amadischem.com/image/1.png\" style=\"height:10mm\"></div>\n <div style=\"clear: both !important; font-size: 0px; line-height: 0px !important; height: 0px !important; padding: 0px !important; margin: 0px !important; display: block; border: 0 !important;\"></div>\n </div>\n <div style=\"height:2px;background:#f39800;margin-bottom:4mm;\"></div>\n <div style=\"padding-bottom:4mm;\"><span style=\"margin-right:4mm;font-size:18pt;font-weight:bold;\">[ CAS No.: {{CASNumber}} ]</span><span>{{ProductEName}}</span></div>\n <table class=\"table1\">\n <tr>\n <td rowspan=\"8\" width=\"30%;\">\n <img src=\"http://120.27.246.38:81/aproduct/image/{{d.ProductID}}\" style=\"max-width:100mm\">\n </td>\n <td width=\"20%;\">CAS No. :</td>\n <td>{{CASNumber}}</td>\n </tr>\n <tr>\n <td>Cat. No. :</td>\n <td>{{ProductNum}}</td>\n </tr>\n <tr>\n <td>Formula :</td>\n <td>{{Cheformula}}</td>\n </tr>\n <tr>\n <td>Purity :</td>\n <td>{{HsCode}}</td>\n </tr>\n <tr>\n <td>M.W :</td>\n <td>{{MolWt}}</td>\n </tr>\n <tr>\n <td>Appearance</td>\n <td>{{Characters}}</td>\n </tr>\n <tr>\n <td>Synonyms :</td>\n <td>{{OName}}</td>\n </tr>\n <tr>\n <td>MDL No. :</td>\n <td>{{MDLNo}}</td>\n </tr>\n <tr>\n <td></td>\n <td>Storage :</td>\n <td>{{PSRes}}</td>\n </tr>\n <tr>\n <td></td>\n <td>InChI Key :</td>\n <td>{{InchiKey}}</td>\n </tr>\n <tr>\n <td></td>\n <td>Pubchem ID :</td>\n <td><span class=\"color1\">{{ExtendF}}</span></td>\n </tr>\n <tr>\n <td></td>\n <td>Boiling Point :</td>\n <td>{{BoilingPoint}}</td>\n </tr>\n </table>\n <table class=\"table2\" style=\"table-layout: fixed;\n width: 100%;\n overflow: hidden;\">\n<tr style=\"height:0px;\">\n <td style=\"width:15%;\"></td>\n <td style=\"width:40%;\"></td>\n <td style=\"width:15%;\"></td>\n <td style=\"width:30%;\"></td>\n </tr>\n <tr>\n <th colspan=\"4\">Safety of [{{CASNumber}}]</th>\n </tr>\n <tr>\n <td style=\"width:15%;\">Signal Word :</td>\n <td style=\"width:40%;\">{{SignalWord}}</td>\n <td style=\"width:15%;\">Class :</td>\n <td style=\"width:30%;\">{{PExtendA}}</td>\n </tr>\n <tr>\n <td>Precautionary Statements :</td>\n <td><div class=\"color1\" style=\"word-wrap: break-word;max-width:200mm;\">{{SafeProperty}}</div></td>\n <td>UN# :</td>\n <td>{{UNNo}}</td>\n </tr>\n <tr>\n <td>Hazard Statements :</td>\n <td><div class=\"color1\" style=\"word-wrap: break-word;max-width:200mm;\">{{RiskPhrase}}</div></td>\n <td>Packing Group :</td>\n <td>{{Useage}}</td>\n </tr>\n <tr>\n <td>GHS Pictogram :</td>\n <td colspan=\"3\">\n {{pic(d.GHS)}}\n </td>\n </tr>\n </table>\n <div class=\"color1\" style=\"margin-top:2mm;\">All chemicals from Amadis Chemical are for laboratory or manufacturing use only.</div>\n <div style=\"color: #888;margin-top:10mm;padding-bottom:4mm;border-bottom:1px solid #ddd;margin-bottom:4mm;\">\n Product Url : <a style=\"color: #297bbf;\" href=\"https://www.amadischem.com/product-{{ProductNum}}\">https://www.amadischem.com/product-{{ProductNum}}</a>\n </div>\n <div style=\"line-height:1.4;\">\n <div class=\"fll\">\n <div style=\"font-size:16pt;font-weight:bold;padding-bottom:2mm;\">Order & Inquiry</div>\n <div>0086-571-89925085</div>\n <div>sales@amadischem.com</div>\n </div>\n <div class=\"flr\">\n <div style=\"font-size:16pt;font-weight:bold;padding-bottom:2mm;\">Support Team</div>\n <div>sales@amadischem.com</div>\n </div>\n <div style=\"clear: both !important; font-size: 0px; line-height: 0px !important; height: 0px !important; padding: 0px !important; margin: 0px !important; display: block; border: 0 !important;\"></div>\n </div>\n</div>\n\n","footer":"","marginTop":0,"marginBottom":0,"marginLeft":0,"marginRight":0,"ResTitle":"打印模板 无","ResDesc":"","RID":26},"data":[[{"RID":120196,"TypeRID":3,"TypeName":"Products","ProductNum":"A948042","ProductCName":"(3S,4S)-托法替尼","ProductEName":"(3S,4S)-4-Methyl-3-(methyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamino) -b-oxo-1-piperidinepropanenitrile","OtherNum":"","TermRID":120196,"TermNum":"A948042","TermName":"1092578-47-6","TermType":1,"Brand":"","BrandName":"","ProClasses":"Impurities","ProClassNames":"杂质","ProTags":"","ProTagNames":"","Grade":null,"LastOrderDate":1735899123,"Advantage":false,"ProductDesc":"","ProductDescEn":"","RelatedProRIDs":null,"PosCh":false,"PosEn":true,"SiteOrderType":0,"SiteFirst":false,"SiteRecommend":false,"SeoTitle":"","SeoDesc":"","SeoKeywords":"","ExtendA":"","ExtendB":"","ExtendC":"","ExtendD":"","ExtendE":"","ExtendF":"20111936","ExtendG":null,"ExtendH":null,"ExtendJ":null,"ExtendK":null,"ExtendL":null,"ExtendM":null,"Url":"/product-A948042","ViewCount":68,"FaviouriteCount":0,"StockWeight":null,"StockWeightInner":null,"StockWeightOuter":null,"StockWeightSupplier":null,"DiscountGroup":null,"TaxRate":null,"LogoPicRID":0,"LogoPicRIDS":null,"TermStructure":true,"TermLogoPicRID":843,"IsClose":false,"RefDocType":2,"RefDocNum":null,"RefDocRID":139153,"RefDocDetailRID":0,"OpId":null,"OpName":null,"OpDate":1721403264,"ChId":null,"ChName":null,"ChDate":1746275083,"DocStatus":"D","DocStatusCH":"","Remark":"","DocTitle":"","ProductID":139153,"RID1":120196,"TermNum1":"A948042","ForbidType":" ","InfoConfirm":true,"CASNumber":"1092578-47-6","CName":"(3S,4S)-托法替尼","EName":"(3S,4S)-4-Methyl-3-(methyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamino) -b-oxo-1-piperidinepropanenitrile","OName":"(3S,4S)-Tofacitinib","ChemdrawName":"(3S,4S)-4-Methyl-3-(methyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamino) -b-oxo-1-piperidinepropanenitrile","Cheformula":"C16H20N6O","MeltingPoint":"","BoilingPoint":"","FlashPoint":null,"Characters":"Off‐white to light yellow powder","ChemicalStability":"","HDP":"","MDLNo":"MFCD11035920","MolWt":"312.37","FMolWt":null,"ExactMass":"312.16986","Chirality":"","SafeProperty":"P261;P305+P351+P338","BioActivity":"","PhyCheProperty":"","Grade1":null,"BarCode":null,"ExpiryMonths":null,"Smiles":"N#CCC(=O)N1CC[C@H](C)[C@H](N(C2N=CN=C3NC=CC=23)C)C1","MolFile":"\n Ketcher 12192413292D 1 1.00000 0.00000 0\n\n 23 25 0 1 0 999 V2000\n -6.9282 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -6.0622 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.1961 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3301 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4641 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8660 0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4752 0.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0684 1.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0739 1.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7321 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3301 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 3 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 11 1 0 0 0 0\n 12 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 10 1 0 0 0 0\n 7 19 1 0 0 0 0\n 19 20 1 1 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 5 1 0 0 0 0\n 4 23 2 0 0 0 0\nM END\n","CanonicalSmiles":"CN([C@@H]1CN(CC[C@@H]1C)C(=O)CC#N)C1N=CN=C2NC=CC2=1","Inchi":"InChI=1S/C16H20N6O/c1-11-5-8-22(14(23)3-6-17)9-13(11)21(2)16-12-4-7-18-15(12)19-10-20-16/h4,7,10-11,13H,3,5,8-9H2,1-2H3,(H,18,19,20)/t11-,13+/m0/s1","InchiKey":"UJLAWZDWDVHWOW-WCQYABFASA-N","UNNo":"","DangerType":"","DangerTypeName":"","RiskPhrase":"H302;H315;H319;H335","SafetyPhrase":"","StoreCondition":"","PTRes":"","PSRes":"Store in 2-8°C for long term (months)","Density":"1.296g/cm3","HazardCodes":"","Features":"","Useage":"","GHS":"GHS07","SignalWord":"Warning","WaterSolubility":"","VaporPressure":"","HsCode":"95%","ExtendA1":null,"ExtendB1":null,"ExtendC1":null,"ExtendD1":null,"ExtendE1":null,"ExtendF1":null,"LogoPicRID1":843,"IsClose1":false,"RefDocType1":2,"RefDocNum1":null,"RefDocRID1":139153,"RefDocDetailRID1":0,"OpId1":null,"OpName1":null,"OpDate1":1721403264,"ChId1":null,"ChName1":null,"ChDate1":1735841524,"DocStatus1":"D","DocStatusCH1":"","Remark1":"","DocTitle1":"A948042 1092578-47-6","PExtendA":""}]]}