| Synonyms | 1-Boc-3,5-difluoro-4-oxo-piperidine-3-carboxylic acid methyl ester |
|---|---|
| Appearance | |
| Storage | Store in 2-8°C for long term (months) |
| Boiling point | |
| Melting point | |
| Flash point | |
| Pubchem ID | |
| Smiles | O=C(N1CC(C(C(C(OC)=O)(C1)F)=O)F)OC(C)(C)C |
| InchiKey | DESBFJFBORFLON-UHFFFAOYSA-N |
| Inchi | InChI=1S/C12H17F2NO5/c1-11(2,3)20-10(18)15-5-7(13)8(16)12(14,6-15)9(17)19-4/h7H,5-6H2,1-4H3 |
| GHS Pictogram | GHS07 |
|---|---|
| Signal Word | Warning |
| Class | |
| Precautionary Statements | P261;P305+P351+P338 |
| UN No. | |
| Hazard Statements | H302;H315;H319;H335 |
| Packing Group |
Sorry, the product description is not available.
Sorry, the literature is not available.
Competitive price
Fast logistics
Technical support
Stock in hand
